C26H39N3O4 — CID 166762945
1-[2-[(1S,2R,5R,7R,10R,11S,14S,15S)-5-hydroxy-2,5,15-trimethyl-14-tetracyclo[8.7.1.02,7.011,15]octadecanyl]-2-oxoethyl]triazole-4-carboxylic acid (PubChem CID 166762945) has the molecular formula C26H39N3O4 and a molecular weight of 457.62 g/mol. Its IUPAC name is 1-[2-[(1S,2R,5R,7R,10R,11S,14S,15S)-5-hydroxy-2,5,15-trimethyl-14-tetracyclo[8.7.1.02,7.011,15]octadecanyl]-2-oxoethyl]triazole-4-carboxylic acid.
| Compound Name | 1-[2-[(1S,2R,5R,7R,10R,11S,14S,15S)-5-hydroxy-2,5,15-trimethyl-14-tetracyclo[8.7.1.02,7.011,15]octadecanyl]-2-oxoethyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 166762945 |
| Molecular Formula | C26H39N3O4 |
| Molecular Weight | 457.62 g/mol |
| Exact Mass | 457.29 |
| IUPAC Name | 1-[2-[(1S,2R,5R,7R,10R,11S,14S,15S)-5-hydroxy-2,5,15-trimethyl-14-tetracyclo[8.7.1.02,7.011,15]octadecanyl]-2-oxoethyl]triazole-4-carboxylic acid |
| SMILES | C[C@@]1(O)CC[C@@]2(C)[C@H](CC[C@@H]3C[C@@H]2CC[C@]2(C)[C@@H](C(=O)Cn4cc(C(=O)O)nn4)CC[C@@H]32)C1 |
| InChI | InChI=1S/C26H39N3O4/c1-24(33)10-11-25(2)17-8-9-26(3)19(16(12-17)4-5-18(25)13-24)6-7-20(26)22(30)15-29-14-21(23(31)32)27-28-29/h14,16-20,33H,4-13,15H2,1-3H3,(H,31,32)/t16-,17+,18-,19+,20-,24-,25-,26+/m1/s1 |
| InChIKey | YSTPESIYRKCXSH-BQPOVOKQSA-N |
| XLogP | 4.35 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.62 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |