C51H66O12 — CID 166764828
ethyl 5-[9-[3-ethoxycarbonyl-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2,7-di(propan-2-yl)fluoren-9-yl]-2-[2-[2-(2-methylperoxyethoxy)ethoxy]ethyl]benzoate (PubChem CID 166764828) has the molecular formula C51H66O12 and a molecular weight of 871.08 g/mol. Its IUPAC name is ethyl 5-[9-[3-ethoxycarbonyl-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2,7-di(propan-2-yl)fluoren-9-yl]-2-[2-[2-(2-methylperoxyethoxy)ethoxy]ethyl]benzoate.
| Compound Name | ethyl 5-[9-[3-ethoxycarbonyl-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2,7-di(propan-2-yl)fluoren-9-yl]-2-[2-[2-(2-methylperoxyethoxy)ethoxy]ethyl]benzoate |
|---|---|
| PubChem CID | 166764828 |
| Molecular Formula | C51H66O12 |
| Molecular Weight | 871.08 g/mol |
| Exact Mass | 870.46 |
| IUPAC Name | ethyl 5-[9-[3-ethoxycarbonyl-4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]phenyl]-2,7-di(propan-2-yl)fluoren-9-yl]-2-[2-[2-(2-methylperoxyethoxy)ethoxy]ethyl]benzoate |
| SMILES | CCOC(=O)c1cc(C2(c3ccc(OCCOCCOCCOC)c(C(=O)OCC)c3)c3cc(C(C)C)ccc3-c3ccc(C(C)C)cc32)ccc1CCOCCOCCOOC |
| InChI | InChI=1S/C51H66O12/c1-9-60-49(52)44-33-40(14-11-37(44)19-20-56-23-24-59-28-30-63-55-8)51(46-31-38(35(3)4)12-16-42(46)43-17-13-39(36(5)6)32-47(43)51)41-15-18-48(45(34-41)50(53)61-10-2)62-29-27-58-26-25-57-22-21-54-7/h11-18,31-36H,9-10,19-30H2,1-8H3 |
| InChIKey | LSCITACYNJJPCD-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.08 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|