C36H34Br2O7 — CID 169075336
ethyl 5-[2,7-dibromo-9-[3-ethoxycarbonyl-4-(3-ethoxypropoxy)phenyl]fluoren-9-yl]-2-hydroxybenzoate (PubChem CID 169075336) has the molecular formula C36H34Br2O7 and a molecular weight of 738.47 g/mol. Its IUPAC name is ethyl 5-[2,7-dibromo-9-[3-ethoxycarbonyl-4-(3-ethoxypropoxy)phenyl]fluoren-9-yl]-2-hydroxybenzoate.
| Compound Name | ethyl 5-[2,7-dibromo-9-[3-ethoxycarbonyl-4-(3-ethoxypropoxy)phenyl]fluoren-9-yl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 169075336 |
| Molecular Formula | C36H34Br2O7 |
| Molecular Weight | 738.47 g/mol |
| Exact Mass | 736.07 |
| IUPAC Name | ethyl 5-[2,7-dibromo-9-[3-ethoxycarbonyl-4-(3-ethoxypropoxy)phenyl]fluoren-9-yl]-2-hydroxybenzoate |
| SMILES | CCOCCCOc1ccc(C2(c3ccc(O)c(C(=O)OCC)c3)c3cc(Br)ccc3-c3ccc(Br)cc32)cc1C(=O)OCC |
| InChI | InChI=1S/C36H34Br2O7/c1-4-42-16-7-17-45-33-15-9-23(19-29(33)35(41)44-6-3)36(22-8-14-32(39)28(18-22)34(40)43-5-2)30-20-24(37)10-12-26(30)27-13-11-25(38)21-31(27)36/h8-15,18-21,39H,4-7,16-17H2,1-3H3 |
| InChIKey | LKNNFEQEJCBYFM-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.47 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|