C19H23N7O2 — CID 166765422
(11S)-11-ethyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide (PubChem CID 166765422) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is (11S)-11-ethyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide.
| Compound Name | (11S)-11-ethyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide |
|---|---|
| PubChem CID | 166765422 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (11S)-11-ethyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-1,3,9-triazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraene-6-carboxamide |
| SMILES | CC[C@H]1CNc2cc(C(N)=O)cc3nc(NC(=O)c4cc(C)nn4CC)n1c23 |
| InChI | InChI=1S/C19H23N7O2/c1-4-12-9-21-13-7-11(17(20)27)8-14-16(13)26(12)19(22-14)23-18(28)15-6-10(3)24-25(15)5-2/h6-8,12,21H,4-5,9H2,1-3H3,(H2,20,27)(H,22,23,28)/t12-/m0/s1 |
| InChIKey | IGBKUGJJQRTEED-LBPRGKRZSA-N |
| XLogP | 2.29 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |