C23H36N2O2 — CID 166767484
N-[2-[4-(4-tert-butylphenyl)piperidine-1-carbonyl]butyl]propanamide (PubChem CID 166767484) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is N-[2-[4-(4-tert-butylphenyl)piperidine-1-carbonyl]butyl]propanamide.
| Compound Name | N-[2-[4-(4-tert-butylphenyl)piperidine-1-carbonyl]butyl]propanamide |
|---|---|
| PubChem CID | 166767484 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | N-[2-[4-(4-tert-butylphenyl)piperidine-1-carbonyl]butyl]propanamide |
| SMILES | CCC(=O)NCC(CC)C(=O)N1CCC(c2ccc(C(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C23H36N2O2/c1-6-17(16-24-21(26)7-2)22(27)25-14-12-19(13-15-25)18-8-10-20(11-9-18)23(3,4)5/h8-11,17,19H,6-7,12-16H2,1-5H3,(H,24,26) |
| InChIKey | YSLIJVPWDRLYIX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |