C28H30ClFN2O4 — CID 166767851
tert-butyl N-[2-[2-[2-(aminomethyl)-5-chloro-2-phenyl-3H-1-benzofuran-4-yl]-3-fluorophenoxy]ethyl]carbamate (PubChem CID 166767851) has the molecular formula C28H30ClFN2O4 and a molecular weight of 513.01 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-(aminomethyl)-5-chloro-2-phenyl-3H-1-benzofuran-4-yl]-3-fluorophenoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-(aminomethyl)-5-chloro-2-phenyl-3H-1-benzofuran-4-yl]-3-fluorophenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 166767851 |
| Molecular Formula | C28H30ClFN2O4 |
| Molecular Weight | 513.01 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | tert-butyl N-[2-[2-[2-(aminomethyl)-5-chloro-2-phenyl-3H-1-benzofuran-4-yl]-3-fluorophenoxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1cccc(F)c1-c1c(Cl)ccc2c1CC(CN)(c1ccccc1)O2 |
| InChI | InChI=1S/C28H30ClFN2O4/c1-27(2,3)36-26(33)32-14-15-34-23-11-7-10-21(30)25(23)24-19-16-28(17-31,18-8-5-4-6-9-18)35-22(19)13-12-20(24)29/h4-13H,14-17,31H2,1-3H3,(H,32,33) |
| InChIKey | QWOMHPCHZMCITJ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.01 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|