C13H18FNO3 — CID 166768010
(3R,4R)-3-fluoro-4-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]pyrrolidine-3-carboxylic acid (PubChem CID 166768010) has the molecular formula C13H18FNO3 and a molecular weight of 255.29 g/mol. Its IUPAC name is (3R,4R)-3-fluoro-4-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R,4R)-3-fluoro-4-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 166768010 |
| Molecular Formula | C13H18FNO3 |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (3R,4R)-3-fluoro-4-[(3E,5E)-6-methoxyhepta-1,3,5-trien-3-yl]pyrrolidine-3-carboxylic acid |
| SMILES | C=C/C(=C\C=C(/C)OC)[C@@H]1CNC[C@@]1(F)C(=O)O |
| InChI | InChI=1S/C13H18FNO3/c1-4-10(6-5-9(2)18-3)11-7-15-8-13(11,14)12(16)17/h4-6,11,15H,1,7-8H2,2-3H3,(H,16,17)/b9-5+,10-6+/t11-,13-/m0/s1 |
| InChIKey | MMMAQUXZVCNKHP-ZXGCNFETSA-N |
| XLogP | 1.66 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|