About azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate
azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate (PubChem CID 166772320) has the molecular formula C13H26N4O2
and a molecular weight of 270.38 g/mol. Its IUPAC name is azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate.
Molecular Properties
| Compound Name | azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate |
| PubChem CID | 166772320 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)C(N)c1ccc(CN)cc1.N.N |
| InChI | InChI=1S/C13H20N2O2.2H3N/c1-13(2,3)17-12(16)11(15)10-6-4-9(8-14)5-7-10;;/h4-7,11H,8,14-15H2,1-3H3;2*1H3 |
| InChIKey | JJCVKLYZQUVKCP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate?
The IUPAC name of azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate (CID 166772320) is azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate.
What is the SMILES notation for azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate?
The canonical SMILES for azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate is CC(C)(C)OC(=O)C(N)c1ccc(CN)cc1.N.N.
What is the InChIKey of azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate?
The InChIKey is JJCVKLYZQUVKCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O2.2H3N/c1-13(2,3)17-12(16)11(15)10-6-4-9(8-14)5-7-10;;/h4-7,11H,8,14-15H2,1-3H3;2*1H3.
What are the key properties of azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate?
azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate has a molecular weight of 270.38 g/mol, XLogP of 1.81, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;tert-butyl 2-amino-2-[4-(aminomethyl)phenyl]acetate is sourced from PubChem (CID 166772320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).