C19H23NO3 — CID 91229930
tert-butyl 2-amino-2-[3-[4-(hydroxymethyl)phenyl]phenyl]acetate (PubChem CID 91229930) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is tert-butyl 2-amino-2-[3-[4-(hydroxymethyl)phenyl]phenyl]acetate.
| Compound Name | tert-butyl 2-amino-2-[3-[4-(hydroxymethyl)phenyl]phenyl]acetate |
|---|---|
| PubChem CID | 91229930 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | tert-butyl 2-amino-2-[3-[4-(hydroxymethyl)phenyl]phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)C(N)c1cccc(-c2ccc(CO)cc2)c1 |
| InChI | InChI=1S/C19H23NO3/c1-19(2,3)23-18(22)17(20)16-6-4-5-15(11-16)14-9-7-13(12-21)8-10-14/h4-11,17,21H,12,20H2,1-3H3 |
| InChIKey | CQMQHEWGBDYPMQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |