C19H20FN3O2 — CID 16677282
3-(4-fluorophenyl)-4-methyl-N-(3-pyridin-2-ylpropyl)-4,5-dihydro-1,2-oxazole-5-carboxamide (PubChem CID 16677282) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-4-methyl-N-(3-pyridin-2-ylpropyl)-4,5-dihydro-1,2-oxazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-4-methyl-N-(3-pyridin-2-ylpropyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 16677282 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-(4-fluorophenyl)-4-methyl-N-(3-pyridin-2-ylpropyl)-4,5-dihydro-1,2-oxazole-5-carboxamide |
| SMILES | CC1C(c2ccc(F)cc2)=NOC1C(=O)NCCCc1ccccn1 |
| InChI | InChI=1S/C19H20FN3O2/c1-13-17(14-7-9-15(20)10-8-14)23-25-18(13)19(24)22-12-4-6-16-5-2-3-11-21-16/h2-3,5,7-11,13,18H,4,6,12H2,1H3,(H,22,24) |
| InChIKey | VIRHCLLNNZQLFA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|