C27H21FN2O4 — CID 166772952
2-[ethyl-(6-fluoro-2-isoindol-2-yl-3-methyl-4-oxochromen-8-yl)amino]benzoic acid (PubChem CID 166772952) has the molecular formula C27H21FN2O4 and a molecular weight of 456.47 g/mol. Its IUPAC name is 2-[ethyl-(6-fluoro-2-isoindol-2-yl-3-methyl-4-oxochromen-8-yl)amino]benzoic acid.
| Compound Name | 2-[ethyl-(6-fluoro-2-isoindol-2-yl-3-methyl-4-oxochromen-8-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 166772952 |
| Molecular Formula | C27H21FN2O4 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 2-[ethyl-(6-fluoro-2-isoindol-2-yl-3-methyl-4-oxochromen-8-yl)amino]benzoic acid |
| SMILES | CCN(c1ccccc1C(=O)O)c1cc(F)cc2c(=O)c(C)c(-n3cc4ccccc4c3)oc12 |
| InChI | InChI=1S/C27H21FN2O4/c1-3-30(22-11-7-6-10-20(22)27(32)33)23-13-19(28)12-21-24(31)16(2)26(34-25(21)23)29-14-17-8-4-5-9-18(17)15-29/h4-15H,3H2,1-2H3,(H,32,33) |
| InChIKey | FXXPSJGDZCIPIM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |