C25H25FN2O4 — CID 166773148
1-[4-(4-fluorophenyl)-7-hydroxy-3-(oxan-4-yl)quinolin-2-yl]pyrrolidine-3-carboxylic acid (PubChem CID 166773148) has the molecular formula C25H25FN2O4 and a molecular weight of 436.48 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)-7-hydroxy-3-(oxan-4-yl)quinolin-2-yl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[4-(4-fluorophenyl)-7-hydroxy-3-(oxan-4-yl)quinolin-2-yl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 166773148 |
| Molecular Formula | C25H25FN2O4 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 1-[4-(4-fluorophenyl)-7-hydroxy-3-(oxan-4-yl)quinolin-2-yl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2nc3cc(O)ccc3c(-c3ccc(F)cc3)c2C2CCOCC2)C1 |
| InChI | InChI=1S/C25H25FN2O4/c26-18-3-1-15(2-4-18)22-20-6-5-19(29)13-21(20)27-24(23(22)16-8-11-32-12-9-16)28-10-7-17(14-28)25(30)31/h1-6,13,16-17,29H,7-12,14H2,(H,30,31) |
| InChIKey | XGRUJWHZJWZJOQ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |