C25H27FN2O4 — CID 166778786
(2S)-2-[[4-(4-fluoro-3-methylphenyl)-7-hydroxy-3-(oxan-4-yl)quinolin-2-yl]amino]-3-hydroxy-2-methylpropanal (PubChem CID 166778786) has the molecular formula C25H27FN2O4 and a molecular weight of 438.50 g/mol. Its IUPAC name is (2S)-2-[[4-(4-fluoro-3-methylphenyl)-7-hydroxy-3-(oxan-4-yl)quinolin-2-yl]amino]-3-hydroxy-2-methylpropanal.
| Compound Name | (2S)-2-[[4-(4-fluoro-3-methylphenyl)-7-hydroxy-3-(oxan-4-yl)quinolin-2-yl]amino]-3-hydroxy-2-methylpropanal |
|---|---|
| PubChem CID | 166778786 |
| Molecular Formula | C25H27FN2O4 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | (2S)-2-[[4-(4-fluoro-3-methylphenyl)-7-hydroxy-3-(oxan-4-yl)quinolin-2-yl]amino]-3-hydroxy-2-methylpropanal |
| SMILES | Cc1cc(-c2c(C3CCOCC3)c(N[C@](C)(C=O)CO)nc3cc(O)ccc23)ccc1F |
| InChI | InChI=1S/C25H27FN2O4/c1-15-11-17(3-6-20(15)26)22-19-5-4-18(31)12-21(19)27-24(28-25(2,13-29)14-30)23(22)16-7-9-32-10-8-16/h3-6,11-13,16,30-31H,7-10,14H2,1-2H3,(H,27,28)/t25-/m1/s1 |
| InChIKey | AEQVVMOENQHOMS-RUZDIDTESA-N |
| XLogP | 4.31 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|