C23H22BrClFNO2 — CID 156879841
7-bromo-2-chloro-4-(4-fluorophenyl)-3-(oxan-4-yl)quinoline-6-carbaldehyde;ethane (PubChem CID 156879841) has the molecular formula C23H22BrClFNO2 and a molecular weight of 478.79 g/mol. Its IUPAC name is 7-bromo-2-chloro-4-(4-fluorophenyl)-3-(oxan-4-yl)quinoline-6-carbaldehyde;ethane.
| Compound Name | 7-bromo-2-chloro-4-(4-fluorophenyl)-3-(oxan-4-yl)quinoline-6-carbaldehyde;ethane |
|---|---|
| PubChem CID | 156879841 |
| Molecular Formula | C23H22BrClFNO2 |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 7-bromo-2-chloro-4-(4-fluorophenyl)-3-(oxan-4-yl)quinoline-6-carbaldehyde;ethane |
| SMILES | CC.O=Cc1cc2c(-c3ccc(F)cc3)c(C3CCOCC3)c(Cl)nc2cc1Br |
| InChI | InChI=1S/C21H16BrClFNO2.C2H6/c22-17-10-18-16(9-14(17)11-26)19(12-1-3-15(24)4-2-12)20(21(23)25-18)13-5-7-27-8-6-13;1-2/h1-4,9-11,13H,5-8H2;1-2H3 |
| InChIKey | GLFWOFFLQAIOAM-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|