About 7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline
7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline (PubChem CID 156879517) has the molecular formula C21H16ClF2N3O
and a molecular weight of 399.83 g/mol. Its IUPAC name is 7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline.
Molecular Properties
| Compound Name | 7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline |
| PubChem CID | 156879517 |
| Molecular Formula | C21H16ClF2N3O |
| Molecular Weight | 399.83 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline |
| SMILES | Fc1ccc(-c2c(C3CCOCC3)c(Cl)nc3c(F)c4[nH]ncc4cc23)cc1 |
| InChI | InChI=1S/C21H16ClF2N3O/c22-21-17(12-5-7-28-8-6-12)16(11-1-3-14(23)4-2-11)15-9-13-10-25-27-19(13)18(24)20(15)26-21/h1-4,9-10,12H,5-8H2,(H,25,27) |
| InChIKey | VQJSWTLWKYHPLC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.83 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline?
The IUPAC name of 7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline (CID 156879517) is 7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline.
What is the SMILES notation for 7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline?
The canonical SMILES for 7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline is Fc1ccc(-c2c(C3CCOCC3)c(Cl)nc3c(F)c4[nH]ncc4cc23)cc1.
What is the InChIKey of 7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline?
The InChIKey is VQJSWTLWKYHPLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16ClF2N3O/c22-21-17(12-5-7-28-8-6-12)16(11-1-3-14(23)4-2-11)15-9-13-10-25-27-19(13)18(24)20(15)26-21/h1-4,9-10,12H,5-8H2,(H,25,27).
What are the key properties of 7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline?
7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline has a molecular weight of 399.83 g/mol, XLogP of 5.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-9-fluoro-5-(4-fluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]quinoline is sourced from PubChem (CID 156879517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).