C25H25ClFN3O — CID 166772142
3-[7-chloro-5-(4-fluorophenyl)-9-methyl-6-propan-2-ylpyrazolo[4,3-g]quinolin-1-yl]-2,2-dimethylpropanal (PubChem CID 166772142) has the molecular formula C25H25ClFN3O and a molecular weight of 437.95 g/mol. Its IUPAC name is 3-[7-chloro-5-(4-fluorophenyl)-9-methyl-6-propan-2-ylpyrazolo[4,3-g]quinolin-1-yl]-2,2-dimethylpropanal.
| Compound Name | 3-[7-chloro-5-(4-fluorophenyl)-9-methyl-6-propan-2-ylpyrazolo[4,3-g]quinolin-1-yl]-2,2-dimethylpropanal |
|---|---|
| PubChem CID | 166772142 |
| Molecular Formula | C25H25ClFN3O |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 3-[7-chloro-5-(4-fluorophenyl)-9-methyl-6-propan-2-ylpyrazolo[4,3-g]quinolin-1-yl]-2,2-dimethylpropanal |
| SMILES | Cc1c2nc(Cl)c(C(C)C)c(-c3ccc(F)cc3)c2cc2cnn(CC(C)(C)C=O)c12 |
| InChI | InChI=1S/C25H25ClFN3O/c1-14(2)20-21(16-6-8-18(27)9-7-16)19-10-17-11-28-30(12-25(4,5)13-31)23(17)15(3)22(19)29-24(20)26/h6-11,13-14H,12H2,1-5H3 |
| InChIKey | VJXDKRICZDKUJI-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|