C28H23ClFN3O3S — CID 156879665
7-chloro-5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-6-(oxan-4-yl)pyrazolo[4,3-g]quinoline (PubChem CID 156879665) has the molecular formula C28H23ClFN3O3S and a molecular weight of 536.03 g/mol. Its IUPAC name is 7-chloro-5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-6-(oxan-4-yl)pyrazolo[4,3-g]quinoline.
| Compound Name | 7-chloro-5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-6-(oxan-4-yl)pyrazolo[4,3-g]quinoline |
|---|---|
| PubChem CID | 156879665 |
| Molecular Formula | C28H23ClFN3O3S |
| Molecular Weight | 536.03 g/mol |
| Exact Mass | 535.11 |
| IUPAC Name | 7-chloro-5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonyl-6-(oxan-4-yl)pyrazolo[4,3-g]quinoline |
| SMILES | Cc1ccc(S(=O)(=O)n2ncc3cc4c(-c5ccc(F)cc5)c(C5CCOCC5)c(Cl)nc4cc32)cc1 |
| InChI | InChI=1S/C28H23ClFN3O3S/c1-17-2-8-22(9-3-17)37(34,35)33-25-15-24-23(14-20(25)16-31-33)26(18-4-6-21(30)7-5-18)27(28(29)32-24)19-10-12-36-13-11-19/h2-9,14-16,19H,10-13H2,1H3 |
| InChIKey | ZPVJNQJCYQVBJO-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.03 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|