C26H24ClF2N3O2 — CID 156879859
8-chloro-5-(3,4-difluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline (PubChem CID 156879859) has the molecular formula C26H24ClF2N3O2 and a molecular weight of 483.95 g/mol. Its IUPAC name is 8-chloro-5-(3,4-difluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline.
| Compound Name | 8-chloro-5-(3,4-difluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline |
|---|---|
| PubChem CID | 156879859 |
| Molecular Formula | C26H24ClF2N3O2 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | 8-chloro-5-(3,4-difluorophenyl)-1-(oxan-2-yl)-6-(oxan-4-yl)pyrazolo[4,3-g]isoquinoline |
| SMILES | Fc1ccc(-c2c(C3CCOCC3)nc(Cl)c3cc4c(cnn4C4CCCCO4)cc23)cc1F |
| InChI | InChI=1S/C26H24ClF2N3O2/c27-26-19-13-22-17(14-30-32(22)23-3-1-2-8-34-23)11-18(19)24(16-4-5-20(28)21(29)12-16)25(31-26)15-6-9-33-10-7-15/h4-5,11-15,23H,1-3,6-10H2 |
| InChIKey | GRSRJIURBHIZER-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|