C24H24F2N3O+ — CID 156879522
5-(3,4-difluorophenyl)-1-(oxan-2-yl)-6-propan-2-yl-2H-pyrazolo[4,3-g]isoquinolin-1-ium (PubChem CID 156879522) has the molecular formula C24H24F2N3O+ and a molecular weight of 408.47 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-1-(oxan-2-yl)-6-propan-2-yl-2H-pyrazolo[4,3-g]isoquinolin-1-ium.
| Compound Name | 5-(3,4-difluorophenyl)-1-(oxan-2-yl)-6-propan-2-yl-2H-pyrazolo[4,3-g]isoquinolin-1-ium |
|---|---|
| PubChem CID | 156879522 |
| Molecular Formula | C24H24F2N3O+ |
| Molecular Weight | 408.47 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 5-(3,4-difluorophenyl)-1-(oxan-2-yl)-6-propan-2-yl-2H-pyrazolo[4,3-g]isoquinolin-1-ium |
| SMILES | CC(C)c1ncc2cc3c(c[nH][n+]3C3CCCCO3)cc2c1-c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C24H23F2N3O/c1-14(2)24-23(15-6-7-19(25)20(26)10-15)18-9-17-13-28-29(22-5-3-4-8-30-22)21(17)11-16(18)12-27-24/h6-7,9-14,22H,3-5,8H2,1-2H3/p+1 |
| InChIKey | QRBDAJIGHWGXSD-UHFFFAOYSA-O |
| XLogP | 5.77 |
| TPSA | 41.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|