C24H25FN3O+ — CID 168754183
5-(4-fluorophenyl)-1-(oxan-2-yl)-6-propan-2-yl-2H-pyrazolo[4,3-g]isoquinolin-1-ium (PubChem CID 168754183) has the molecular formula C24H25FN3O+ and a molecular weight of 390.48 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-1-(oxan-2-yl)-6-propan-2-yl-2H-pyrazolo[4,3-g]isoquinolin-1-ium.
| Compound Name | 5-(4-fluorophenyl)-1-(oxan-2-yl)-6-propan-2-yl-2H-pyrazolo[4,3-g]isoquinolin-1-ium |
|---|---|
| PubChem CID | 168754183 |
| Molecular Formula | C24H25FN3O+ |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 5-(4-fluorophenyl)-1-(oxan-2-yl)-6-propan-2-yl-2H-pyrazolo[4,3-g]isoquinolin-1-ium |
| SMILES | CC(C)c1ncc2cc3c(c[nH][n+]3C3CCCCO3)cc2c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C24H24FN3O/c1-15(2)24-23(16-6-8-19(25)9-7-16)20-11-18-14-27-28(22-5-3-4-10-29-22)21(18)12-17(20)13-26-24/h6-9,11-15,22H,3-5,10H2,1-2H3/p+1 |
| InChIKey | KDZCMWZZRAUECI-UHFFFAOYSA-O |
| XLogP | 5.63 |
| TPSA | 41.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|