C25H26FNO4 — CID 156880226
4-[4-(4-fluoro-3-methylphenyl)-7-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]butanoic acid (PubChem CID 156880226) has the molecular formula C25H26FNO4 and a molecular weight of 423.48 g/mol. Its IUPAC name is 4-[4-(4-fluoro-3-methylphenyl)-7-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]butanoic acid.
| Compound Name | 4-[4-(4-fluoro-3-methylphenyl)-7-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 156880226 |
| Molecular Formula | C25H26FNO4 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 4-[4-(4-fluoro-3-methylphenyl)-7-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]butanoic acid |
| SMILES | Cc1cc(-c2c(C3CCOCC3)nc(CCCC(=O)O)c3cc(O)ccc23)ccc1F |
| InChI | InChI=1S/C25H26FNO4/c1-15-13-17(5-8-21(15)26)24-19-7-6-18(28)14-20(19)22(3-2-4-23(29)30)27-25(24)16-9-11-31-12-10-16/h5-8,13-14,16,28H,2-4,9-12H2,1H3,(H,29,30) |
| InChIKey | NTQZKTIQBZYICL-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |