C24H23FN2O4 — CID 168754367
(3S)-3-[4-(4-fluorophenyl)-7-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]oxypyrrolidin-2-one (PubChem CID 168754367) has the molecular formula C24H23FN2O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is (3S)-3-[4-(4-fluorophenyl)-7-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]oxypyrrolidin-2-one.
| Compound Name | (3S)-3-[4-(4-fluorophenyl)-7-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]oxypyrrolidin-2-one |
|---|---|
| PubChem CID | 168754367 |
| Molecular Formula | C24H23FN2O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (3S)-3-[4-(4-fluorophenyl)-7-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]oxypyrrolidin-2-one |
| SMILES | O=C1NCC[C@@H]1Oc1nc(C2CCOCC2)c(-c2ccc(F)cc2)c2ccc(O)cc12 |
| InChI | InChI=1S/C24H23FN2O4/c25-16-3-1-14(2-4-16)21-18-6-5-17(28)13-19(18)24(31-20-7-10-26-23(20)29)27-22(21)15-8-11-30-12-9-15/h1-6,13,15,20,28H,7-12H2,(H,26,29)/t20-/m0/s1 |
| InChIKey | XGFROTXPOJZIMC-FQEVSTJZSA-N |
| XLogP | 3.91 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |