C27H30FNO4 — CID 156880221
ethyl 4-[4-(4-fluoro-3-methylphenyl)-7-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]butanoate (PubChem CID 156880221) has the molecular formula C27H30FNO4 and a molecular weight of 451.54 g/mol. Its IUPAC name is ethyl 4-[4-(4-fluoro-3-methylphenyl)-7-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]butanoate.
| Compound Name | ethyl 4-[4-(4-fluoro-3-methylphenyl)-7-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]butanoate |
|---|---|
| PubChem CID | 156880221 |
| Molecular Formula | C27H30FNO4 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | ethyl 4-[4-(4-fluoro-3-methylphenyl)-7-hydroxy-3-(oxan-4-yl)isoquinolin-1-yl]butanoate |
| SMILES | CCOC(=O)CCCc1nc(C2CCOCC2)c(-c2ccc(F)c(C)c2)c2ccc(O)cc12 |
| InChI | InChI=1S/C27H30FNO4/c1-3-33-25(31)6-4-5-24-22-16-20(30)8-9-21(22)26(19-7-10-23(28)17(2)15-19)27(29-24)18-11-13-32-14-12-18/h7-10,15-16,18,30H,3-6,11-14H2,1-2H3 |
| InChIKey | YDPFDVZSDPTGOK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |