C30H33FN4O4 — CID 156879498
2-[6-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-(oxan-4-yl)isoquinolin-1-yl]oxy-3-azabicyclo[3.2.0]heptan-3-yl]propanoic acid (PubChem CID 156879498) has the molecular formula C30H33FN4O4 and a molecular weight of 532.62 g/mol. Its IUPAC name is 2-[6-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-(oxan-4-yl)isoquinolin-1-yl]oxy-3-azabicyclo[3.2.0]heptan-3-yl]propanoic acid.
| Compound Name | 2-[6-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-(oxan-4-yl)isoquinolin-1-yl]oxy-3-azabicyclo[3.2.0]heptan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 156879498 |
| Molecular Formula | C30H33FN4O4 |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 2-[6-[7-amino-4-(4-fluorophenyl)-6-methanimidoyl-3-(oxan-4-yl)isoquinolin-1-yl]oxy-3-azabicyclo[3.2.0]heptan-3-yl]propanoic acid |
| SMILES | [H]/N=C/c1cc2c(-c3ccc(F)cc3)c(C3CCOCC3)nc(OC3CC4CN(C(C)C(=O)O)CC43)c2cc1N |
| InChI | InChI=1S/C30H33FN4O4/c1-16(30(36)37)35-14-20-11-26(24(20)15-35)39-29-23-12-25(33)19(13-32)10-22(23)27(17-2-4-21(31)5-3-17)28(34-29)18-6-8-38-9-7-18/h2-5,10,12-13,16,18,20,24,26,32H,6-9,11,14-15,33H2,1H3,(H,36,37)/b32-13+ |
| InChIKey | JPJVFKJMHWPVIB-JJKQSNDFSA-N |
| XLogP | 4.69 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|