C27H27F2N3O4 — CID 156879621
8-cyclopentyloxy-5-(3,4-difluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]isoquinoline;formic acid (PubChem CID 156879621) has the molecular formula C27H27F2N3O4 and a molecular weight of 495.53 g/mol. Its IUPAC name is 8-cyclopentyloxy-5-(3,4-difluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]isoquinoline;formic acid.
| Compound Name | 8-cyclopentyloxy-5-(3,4-difluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]isoquinoline;formic acid |
|---|---|
| PubChem CID | 156879621 |
| Molecular Formula | C27H27F2N3O4 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 8-cyclopentyloxy-5-(3,4-difluorophenyl)-6-(oxan-4-yl)-1H-pyrazolo[4,3-g]isoquinoline;formic acid |
| SMILES | Fc1ccc(-c2c(C3CCOCC3)nc(OC3CCCC3)c3cc4[nH]ncc4cc23)cc1F.O=CO |
| InChI | InChI=1S/C26H25F2N3O2.CH2O2/c27-21-6-5-16(12-22(21)28)24-19-11-17-14-29-31-23(17)13-20(19)26(33-18-3-1-2-4-18)30-25(24)15-7-9-32-10-8-15;2-1-3/h5-6,11-15,18H,1-4,7-10H2,(H,29,31);1H,(H,2,3) |
| InChIKey | VRDIODFRBVWGQM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|