C22H43N — CID 166774205
3-methyl-1-(4-methyl-6-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)nonan-1-amine (PubChem CID 166774205) has the molecular formula C22H43N and a molecular weight of 321.59 g/mol. Its IUPAC name is 3-methyl-1-(4-methyl-6-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)nonan-1-amine.
| Compound Name | 3-methyl-1-(4-methyl-6-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)nonan-1-amine |
|---|---|
| PubChem CID | 166774205 |
| Molecular Formula | C22H43N |
| Molecular Weight | 321.59 g/mol |
| Exact Mass | 321.34 |
| IUPAC Name | 3-methyl-1-(4-methyl-6-propan-2-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)nonan-1-amine |
| SMILES | CCCCCCC(C)CC(N)C1CC2C(C)CC(C(C)C)C2C1 |
| InChI | InChI=1S/C22H43N/c1-6-7-8-9-10-16(4)11-22(23)18-13-20-17(5)12-19(15(2)3)21(20)14-18/h15-22H,6-14,23H2,1-5H3 |
| InChIKey | UJNGYVLJAHJDNT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.59 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|