C28H29N7O2 — CID 166775256
4-[8-amino-3-(1-prop-2-enoylazepan-2-yl)imidazo[1,5-a]pyrazin-1-yl]-N-methyl-N-pyridin-2-ylbenzamide (PubChem CID 166775256) has the molecular formula C28H29N7O2 and a molecular weight of 495.59 g/mol. Its IUPAC name is 4-[8-amino-3-(1-prop-2-enoylazepan-2-yl)imidazo[1,5-a]pyrazin-1-yl]-N-methyl-N-pyridin-2-ylbenzamide.
| Compound Name | 4-[8-amino-3-(1-prop-2-enoylazepan-2-yl)imidazo[1,5-a]pyrazin-1-yl]-N-methyl-N-pyridin-2-ylbenzamide |
|---|---|
| PubChem CID | 166775256 |
| Molecular Formula | C28H29N7O2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 4-[8-amino-3-(1-prop-2-enoylazepan-2-yl)imidazo[1,5-a]pyrazin-1-yl]-N-methyl-N-pyridin-2-ylbenzamide |
| SMILES | C=CC(=O)N1CCCCCC1c1nc(-c2ccc(C(=O)N(C)c3ccccn3)cc2)c2c(N)nccn12 |
| InChI | InChI=1S/C28H29N7O2/c1-3-23(36)34-17-8-4-5-9-21(34)27-32-24(25-26(29)31-16-18-35(25)27)19-11-13-20(14-12-19)28(37)33(2)22-10-6-7-15-30-22/h3,6-7,10-16,18,21H,1,4-5,8-9,17H2,2H3,(H2,29,31) |
| InChIKey | USPOSRGMZKFTGP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|