C29H30F3N7O2 — CID 166775314
4-[8-amino-3-(1-prop-2-enoylpiperidin-2-yl)imidazo[1,5-a]pyrazin-1-yl]-N-[C-prop-2-enyl-N-[(Z)-4,4,4-trifluorobut-1-enyl]carbonimidoyl]benzamide (PubChem CID 166775314) has the molecular formula C29H30F3N7O2 and a molecular weight of 565.60 g/mol. Its IUPAC name is 4-[8-amino-3-(1-prop-2-enoylpiperidin-2-yl)imidazo[1,5-a]pyrazin-1-yl]-N-[C-prop-2-enyl-N-[(Z)-4,4,4-trifluorobut-1-enyl]carbonimidoyl]benzamide.
| Compound Name | 4-[8-amino-3-(1-prop-2-enoylpiperidin-2-yl)imidazo[1,5-a]pyrazin-1-yl]-N-[C-prop-2-enyl-N-[(Z)-4,4,4-trifluorobut-1-enyl]carbonimidoyl]benzamide |
|---|---|
| PubChem CID | 166775314 |
| Molecular Formula | C29H30F3N7O2 |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | 4-[8-amino-3-(1-prop-2-enoylpiperidin-2-yl)imidazo[1,5-a]pyrazin-1-yl]-N-[C-prop-2-enyl-N-[(Z)-4,4,4-trifluorobut-1-enyl]carbonimidoyl]benzamide |
| SMILES | C=CC/C(=N\C=C/CC(F)(F)F)NC(=O)c1ccc(-c2nc(C3CCCCN3C(=O)C=C)n3ccnc(N)c23)cc1 |
| InChI | InChI=1S/C29H30F3N7O2/c1-3-8-22(34-15-7-14-29(30,31)32)36-28(41)20-12-10-19(11-13-20)24-25-26(33)35-16-18-39(25)27(37-24)21-9-5-6-17-38(21)23(40)4-2/h3-4,7,10-13,15-16,18,21H,1-2,5-6,8-9,14,17H2,(H2,33,35)(H,34,36,41)/b15-7- |
| InChIKey | XQBKHFYAPBBNJR-CHHVJCJISA-N |
| XLogP | 5.39 |
| TPSA | 117.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|