C19H35NO — CID 166775284
5-methyl-3-(7-methyltetradecan-7-yl)-1,2-oxazole (PubChem CID 166775284) has the molecular formula C19H35NO and a molecular weight of 293.49 g/mol. Its IUPAC name is 5-methyl-3-(7-methyltetradecan-7-yl)-1,2-oxazole.
| Compound Name | 5-methyl-3-(7-methyltetradecan-7-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 166775284 |
| Molecular Formula | C19H35NO |
| Molecular Weight | 293.49 g/mol |
| Exact Mass | 293.27 |
| IUPAC Name | 5-methyl-3-(7-methyltetradecan-7-yl)-1,2-oxazole |
| SMILES | CCCCCCCC(C)(CCCCCC)c1cc(C)on1 |
| InChI | InChI=1S/C19H35NO/c1-5-7-9-11-13-15-19(4,14-12-10-8-6-2)18-16-17(3)21-20-18/h16H,5-15H2,1-4H3 |
| InChIKey | DIRWVVJBMPTNLE-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.49 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|