C13H26N2 — CID 166775426
4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine (PubChem CID 166775426) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine.
| Compound Name | 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 166775426 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine |
| SMILES | C/C=C(\N=C\C(C)C(C)NC)C(C)(C)C |
| InChI | InChI=1S/C13H26N2/c1-8-12(13(4,5)6)15-9-10(2)11(3)14-7/h8-11,14H,1-7H3/b12-8-,15-9+ |
| InChIKey | ZJLSLFFVFMNKNW-MSDVTEOZSA-N |
| XLogP | 3.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|