About 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine
4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine (PubChem CID 166775426) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine.
Molecular Properties
| Compound Name | 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine |
| PubChem CID | 166775426 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine |
| SMILES | C/C=C(\N=C\C(C)C(C)NC)C(C)(C)C |
| InChI | InChI=1S/C13H26N2/c1-8-12(13(4,5)6)15-9-10(2)11(3)14-7/h8-11,14H,1-7H3/b12-8-,15-9+ |
| InChIKey | ZJLSLFFVFMNKNW-MSDVTEOZSA-N |
| XLogP | 3.25 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine?
The IUPAC name of 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine (CID 166775426) is 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine.
What is the SMILES notation for 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine?
The canonical SMILES for 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine is C/C=C(\N=C\C(C)C(C)NC)C(C)(C)C.
What is the InChIKey of 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine?
The InChIKey is ZJLSLFFVFMNKNW-MSDVTEOZSA-N. The full InChI is InChI=1S/C13H26N2/c1-8-12(13(4,5)6)15-9-10(2)11(3)14-7/h8-11,14H,1-7H3/b12-8-,15-9+.
What are the key properties of 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine?
4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine has a molecular weight of 210.36 g/mol, XLogP of 3.25, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-4,4-dimethylpent-2-en-3-yl]imino-N,3-dimethylbutan-2-amine is sourced from PubChem (CID 166775426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).