C21H24N2O5 — CID 166776149
4-[[(4-carboxyphenyl)methyl-[2-(hydroxyamino)pent-2-enyl]amino]methyl]benzoic acid (PubChem CID 166776149) has the molecular formula C21H24N2O5 and a molecular weight of 384.43 g/mol. Its IUPAC name is 4-[[(4-carboxyphenyl)methyl-[2-(hydroxyamino)pent-2-enyl]amino]methyl]benzoic acid.
| Compound Name | 4-[[(4-carboxyphenyl)methyl-[2-(hydroxyamino)pent-2-enyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 166776149 |
| Molecular Formula | C21H24N2O5 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 4-[[(4-carboxyphenyl)methyl-[2-(hydroxyamino)pent-2-enyl]amino]methyl]benzoic acid |
| SMILES | CCC=C(CN(Cc1ccc(C(=O)O)cc1)Cc1ccc(C(=O)O)cc1)NO |
| InChI | InChI=1S/C21H24N2O5/c1-2-3-19(22-28)14-23(12-15-4-8-17(9-5-15)20(24)25)13-16-6-10-18(11-7-16)21(26)27/h3-11,22,28H,2,12-14H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | BTDAQPWDSSHATQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|