C21H20N6O4 — CID 166776411
7-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3,4-dihydroquinoline-2-carbonitrile (PubChem CID 166776411) has the molecular formula C21H20N6O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is 7-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3,4-dihydroquinoline-2-carbonitrile.
| Compound Name | 7-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3,4-dihydroquinoline-2-carbonitrile |
|---|---|
| PubChem CID | 166776411 |
| Molecular Formula | C21H20N6O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 7-[[(2R,3S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxyoxolan-2-yl]methoxy]-3,4-dihydroquinoline-2-carbonitrile |
| SMILES | N#CC1=Nc2cc(OC[C@H]3O[C@@H](n4ccc5c(N)ncnc54)[C@H](O)[C@@H]3O)ccc2CC1 |
| InChI | InChI=1S/C21H20N6O4/c22-8-12-3-1-11-2-4-13(7-15(11)26-12)30-9-16-17(28)18(29)21(31-16)27-6-5-14-19(23)24-10-25-20(14)27/h2,4-7,10,16-18,21,28-29H,1,3,9H2,(H2,23,24,25)/t16-,17-,18-,21-/m1/s1 |
| InChIKey | YZSQBGGXNKVASK-NEYJZJCJSA-N |
| XLogP | 1.25 |
| TPSA | 151.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |