C27H35N3O7 — CID 166778603
2-[4-[2-acetamido-3-oxo-3-(pentylamino)propyl]-N-[2-(dihydroxymethyl)phenyl]-2-ethylanilino]-2-oxoacetic acid (PubChem CID 166778603) has the molecular formula C27H35N3O7 and a molecular weight of 513.59 g/mol. Its IUPAC name is 2-[4-[2-acetamido-3-oxo-3-(pentylamino)propyl]-N-[2-(dihydroxymethyl)phenyl]-2-ethylanilino]-2-oxoacetic acid.
| Compound Name | 2-[4-[2-acetamido-3-oxo-3-(pentylamino)propyl]-N-[2-(dihydroxymethyl)phenyl]-2-ethylanilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 166778603 |
| Molecular Formula | C27H35N3O7 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | 2-[4-[2-acetamido-3-oxo-3-(pentylamino)propyl]-N-[2-(dihydroxymethyl)phenyl]-2-ethylanilino]-2-oxoacetic acid |
| SMILES | CCCCCNC(=O)C(Cc1ccc(N(C(=O)C(=O)O)c2ccccc2C(O)O)c(CC)c1)NC(C)=O |
| InChI | InChI=1S/C27H35N3O7/c1-4-6-9-14-28-24(32)21(29-17(3)31)16-18-12-13-22(19(5-2)15-18)30(25(33)27(36)37)23-11-8-7-10-20(23)26(34)35/h7-8,10-13,15,21,26,34-35H,4-6,9,14,16H2,1-3H3,(H,28,32)(H,29,31)(H,36,37) |
| InChIKey | KJVWUNNTGZXDSP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 156.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|