C39H52N8O2 — CID 166778834
N-(3-azidopropyl)-4-[2,6-ditert-butyl-4-[6-[4-(4-methylpiperazin-1-yl)phenyl]-1H-benzimidazol-2-yl]phenoxy]butanamide (PubChem CID 166778834) has the molecular formula C39H52N8O2 and a molecular weight of 664.90 g/mol. Its IUPAC name is N-(3-azidopropyl)-4-[2,6-ditert-butyl-4-[6-[4-(4-methylpiperazin-1-yl)phenyl]-1H-benzimidazol-2-yl]phenoxy]butanamide.
| Compound Name | N-(3-azidopropyl)-4-[2,6-ditert-butyl-4-[6-[4-(4-methylpiperazin-1-yl)phenyl]-1H-benzimidazol-2-yl]phenoxy]butanamide |
|---|---|
| PubChem CID | 166778834 |
| Molecular Formula | C39H52N8O2 |
| Molecular Weight | 664.90 g/mol |
| Exact Mass | 664.42 |
| IUPAC Name | N-(3-azidopropyl)-4-[2,6-ditert-butyl-4-[6-[4-(4-methylpiperazin-1-yl)phenyl]-1H-benzimidazol-2-yl]phenoxy]butanamide |
| SMILES | CN1CCN(c2ccc(-c3ccc4nc(-c5cc(C(C)(C)C)c(OCCCC(=O)NCCCN=[N+]=[N-])c(C(C)(C)C)c5)[nH]c4c3)cc2)CC1 |
| InChI | InChI=1S/C39H52N8O2/c1-38(2,3)31-24-29(25-32(39(4,5)6)36(31)49-23-8-10-35(48)41-17-9-18-42-45-40)37-43-33-16-13-28(26-34(33)44-37)27-11-14-30(15-12-27)47-21-19-46(7)20-22-47/h11-16,24-26H,8-10,17-23H2,1-7H3,(H,41,48)(H,43,44) |
| InChIKey | KGMHEDHKCHTFNQ-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 122.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.90 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|