C18H20N4O3 — CID 16677947
2-morpholin-4-yl-N-(2-prop-2-enoxyphenyl)pyrimidine-5-carboxamide (PubChem CID 16677947) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-morpholin-4-yl-N-(2-prop-2-enoxyphenyl)pyrimidine-5-carboxamide.
| Compound Name | 2-morpholin-4-yl-N-(2-prop-2-enoxyphenyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 16677947 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-morpholin-4-yl-N-(2-prop-2-enoxyphenyl)pyrimidine-5-carboxamide |
| SMILES | C=CCOc1ccccc1NC(=O)c1cnc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C18H20N4O3/c1-2-9-25-16-6-4-3-5-15(16)21-17(23)14-12-19-18(20-13-14)22-7-10-24-11-8-22/h2-6,12-13H,1,7-11H2,(H,21,23) |
| InChIKey | VESGVLCWDACWCK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|