C17H13F3N4O2 — CID 166780003
N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-[(4-methylpyrazol-1-yl)methyl]but-3-ynamide (PubChem CID 166780003) has the molecular formula C17H13F3N4O2 and a molecular weight of 362.31 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-[(4-methylpyrazol-1-yl)methyl]but-3-ynamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-[(4-methylpyrazol-1-yl)methyl]but-3-ynamide |
|---|---|
| PubChem CID | 166780003 |
| Molecular Formula | C17H13F3N4O2 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-[(4-methylpyrazol-1-yl)methyl]but-3-ynamide |
| SMILES | C#CC(O)(Cn1cc(C)cn1)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F3N4O2/c1-3-16(26,10-24-9-11(2)8-22-24)15(25)23-13-5-4-12(7-21)14(6-13)17(18,19)20/h1,4-6,8-9,26H,10H2,2H3,(H,23,25) |
| InChIKey | UNQDJQVXYIDKQE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|