C23H28F3N7O2 — CID 166781639
(1R,5S)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[1-propan-2-yl-5-[2-(2,2,2-trifluoroethyl)phenoxy]-1,2,4-triazol-3-yl]-3-azabicyclo[3.2.1]octan-8-amine (PubChem CID 166781639) has the molecular formula C23H28F3N7O2 and a molecular weight of 491.52 g/mol. Its IUPAC name is (1R,5S)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[1-propan-2-yl-5-[2-(2,2,2-trifluoroethyl)phenoxy]-1,2,4-triazol-3-yl]-3-azabicyclo[3.2.1]octan-8-amine.
| Compound Name | (1R,5S)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[1-propan-2-yl-5-[2-(2,2,2-trifluoroethyl)phenoxy]-1,2,4-triazol-3-yl]-3-azabicyclo[3.2.1]octan-8-amine |
|---|---|
| PubChem CID | 166781639 |
| Molecular Formula | C23H28F3N7O2 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | (1R,5S)-3-(3-methyl-1,2,4-oxadiazol-5-yl)-N-[1-propan-2-yl-5-[2-(2,2,2-trifluoroethyl)phenoxy]-1,2,4-triazol-3-yl]-3-azabicyclo[3.2.1]octan-8-amine |
| SMILES | Cc1noc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc(Oc3ccccc3CC(F)(F)F)n(C(C)C)n2)n1 |
| InChI | InChI=1S/C23H28F3N7O2/c1-13(2)33-22(34-18-7-5-4-6-15(18)10-23(24,25)26)29-20(30-33)28-19-16-8-9-17(19)12-32(11-16)21-27-14(3)31-35-21/h4-7,13,16-17,19H,8-12H2,1-3H3,(H,28,30)/t16-,17+,19? |
| InChIKey | NAUKXVPETVEHDI-JJTKIYQPSA-N |
| XLogP | 4.77 |
| TPSA | 94.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |