C16H21FN2O4S — CID 166786648
2-[7-fluoro-4-oxo-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]cinnolin-3-yl]acetic acid (PubChem CID 166786648) has the molecular formula C16H21FN2O4S and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-[7-fluoro-4-oxo-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]cinnolin-3-yl]acetic acid.
| Compound Name | 2-[7-fluoro-4-oxo-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]cinnolin-3-yl]acetic acid |
|---|---|
| PubChem CID | 166786648 |
| Molecular Formula | C16H21FN2O4S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-[7-fluoro-4-oxo-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]cinnolin-3-yl]acetic acid |
| SMILES | CS(C)(C)CCOCn1nc(CC(=O)O)c(=O)c2ccc(F)cc21 |
| InChI | InChI=1S/C16H21FN2O4S/c1-24(2,3)7-6-23-10-19-14-8-11(17)4-5-12(14)16(22)13(18-19)9-15(20)21/h4-5,8H,6-7,9-10H2,1-3H3,(H,20,21) |
| InChIKey | SHDUERDCSZZUQS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|