C18H22F2N4O2S — CID 143415028
2-[[6-(2,4-difluorophenoxy)-3-methylpyrazolo[3,4-d]pyrimidin-1-yl]methoxy]ethyl-trimethyl-λ4-sulfane (PubChem CID 143415028) has the molecular formula C18H22F2N4O2S and a molecular weight of 396.46 g/mol. Its IUPAC name is 2-[[6-(2,4-difluorophenoxy)-3-methylpyrazolo[3,4-d]pyrimidin-1-yl]methoxy]ethyl-trimethyl-λ4-sulfane.
| Compound Name | 2-[[6-(2,4-difluorophenoxy)-3-methylpyrazolo[3,4-d]pyrimidin-1-yl]methoxy]ethyl-trimethyl-λ4-sulfane |
|---|---|
| PubChem CID | 143415028 |
| Molecular Formula | C18H22F2N4O2S |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-[[6-(2,4-difluorophenoxy)-3-methylpyrazolo[3,4-d]pyrimidin-1-yl]methoxy]ethyl-trimethyl-λ4-sulfane |
| SMILES | Cc1nn(COCCS(C)(C)C)c2nc(Oc3ccc(F)cc3F)ncc12 |
| InChI | InChI=1S/C18H22F2N4O2S/c1-12-14-10-21-18(26-16-6-5-13(19)9-15(16)20)22-17(14)24(23-12)11-25-7-8-27(2,3)4/h5-6,9-10H,7-8,11H2,1-4H3 |
| InChIKey | INHCXPAQFVLFMZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|