C21H16F4N2O3 — CID 91268877
1-[2,4-bis(2,4-difluorophenoxy)pyrimidin-5-yl]-3-methylbutan-2-one (PubChem CID 91268877) has the molecular formula C21H16F4N2O3 and a molecular weight of 420.36 g/mol. Its IUPAC name is 1-[2,4-bis(2,4-difluorophenoxy)pyrimidin-5-yl]-3-methylbutan-2-one.
| Compound Name | 1-[2,4-bis(2,4-difluorophenoxy)pyrimidin-5-yl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 91268877 |
| Molecular Formula | C21H16F4N2O3 |
| Molecular Weight | 420.36 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 1-[2,4-bis(2,4-difluorophenoxy)pyrimidin-5-yl]-3-methylbutan-2-one |
| SMILES | CC(C)C(=O)Cc1cnc(Oc2ccc(F)cc2F)nc1Oc1ccc(F)cc1F |
| InChI | InChI=1S/C21H16F4N2O3/c1-11(2)17(28)7-12-10-26-21(30-19-6-4-14(23)9-16(19)25)27-20(12)29-18-5-3-13(22)8-15(18)24/h3-6,8-11H,7H2,1-2H3 |
| InChIKey | QPVHMMNUJHPZEN-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |