C17H14F2N4O2 — CID 16678701
1-[3-(2,4-difluoro-3-pyridinyl)phenyl]-N-(methoxymethyl)imidazole-4-carboxamide (PubChem CID 16678701) has the molecular formula C17H14F2N4O2 and a molecular weight of 344.32 g/mol. Its IUPAC name is 1-[3-(2,4-difluoro-3-pyridinyl)phenyl]-N-(methoxymethyl)imidazole-4-carboxamide.
| Compound Name | 1-[3-(2,4-difluoro-3-pyridinyl)phenyl]-N-(methoxymethyl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 16678701 |
| Molecular Formula | C17H14F2N4O2 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 1-[3-(2,4-difluoro-3-pyridinyl)phenyl]-N-(methoxymethyl)imidazole-4-carboxamide |
| SMILES | COCNC(=O)c1cn(-c2cccc(-c3c(F)ccnc3F)c2)cn1 |
| InChI | InChI=1S/C17H14F2N4O2/c1-25-10-22-17(24)14-8-23(9-21-14)12-4-2-3-11(7-12)15-13(18)5-6-20-16(15)19/h2-9H,10H2,1H3,(H,22,24) |
| InChIKey | HKLRLCDPEKTFCN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|