C19H16F3N3O3 — CID 67429505
N-(methoxymethyl)-1-[3-[2-(trifluoromethoxy)phenyl]phenyl]imidazole-4-carboxamide (PubChem CID 67429505) has the molecular formula C19H16F3N3O3 and a molecular weight of 391.35 g/mol. Its IUPAC name is N-(methoxymethyl)-1-[3-[2-(trifluoromethoxy)phenyl]phenyl]imidazole-4-carboxamide.
| Compound Name | N-(methoxymethyl)-1-[3-[2-(trifluoromethoxy)phenyl]phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 67429505 |
| Molecular Formula | C19H16F3N3O3 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | N-(methoxymethyl)-1-[3-[2-(trifluoromethoxy)phenyl]phenyl]imidazole-4-carboxamide |
| SMILES | COCNC(=O)c1cn(-c2cccc(-c3ccccc3OC(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C19H16F3N3O3/c1-27-12-24-18(26)16-10-25(11-23-16)14-6-4-5-13(9-14)15-7-2-3-8-17(15)28-19(20,21)22/h2-11H,12H2,1H3,(H,24,26) |
| InChIKey | AMQQHUWBEACIEQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|