C21H16N2O3 — CID 67430389
furan-2-yl-[1-[3-(2-methoxyphenyl)phenyl]imidazol-4-yl]methanone (PubChem CID 67430389) has the molecular formula C21H16N2O3 and a molecular weight of 344.37 g/mol. Its IUPAC name is furan-2-yl-[1-[3-(2-methoxyphenyl)phenyl]imidazol-4-yl]methanone.
| Compound Name | furan-2-yl-[1-[3-(2-methoxyphenyl)phenyl]imidazol-4-yl]methanone |
|---|---|
| PubChem CID | 67430389 |
| Molecular Formula | C21H16N2O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | furan-2-yl-[1-[3-(2-methoxyphenyl)phenyl]imidazol-4-yl]methanone |
| SMILES | COc1ccccc1-c1cccc(-n2cnc(C(=O)c3ccco3)c2)c1 |
| InChI | InChI=1S/C21H16N2O3/c1-25-19-9-3-2-8-17(19)15-6-4-7-16(12-15)23-13-18(22-14-23)21(24)20-10-5-11-26-20/h2-14H,1H3 |
| InChIKey | HKFCPWFIWNEPGO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |