About [1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole
[1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole (PubChem CID 67430070) has the molecular formula C24H19ClN4O2
and a molecular weight of 430.90 g/mol. Its IUPAC name is [1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole.
Molecular Properties
| Compound Name | [1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole |
| PubChem CID | 67430070 |
| Molecular Formula | C24H19ClN4O2 |
| Molecular Weight | 430.90 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | [1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole |
| SMILES | Cn1ccnc1.O=C(c1cn(-c2cccc(-c3ccccc3Cl)c2)cn1)c1ccco1 |
| InChI | InChI=1S/C20H13ClN2O2.C4H6N2/c21-17-8-2-1-7-16(17)14-5-3-6-15(11-14)23-12-18(22-13-23)20(24)19-9-4-10-25-19;1-6-3-2-5-4-6/h1-13H;2-4H,1H3 |
| InChIKey | QJLYFVDUOBXPJD-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 65.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.90 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole?
The IUPAC name of [1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole (CID 67430070) is [1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole.
What is the SMILES notation for [1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole?
The canonical SMILES for [1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole is Cn1ccnc1.O=C(c1cn(-c2cccc(-c3ccccc3Cl)c2)cn1)c1ccco1.
What is the InChIKey of [1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole?
The InChIKey is QJLYFVDUOBXPJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13ClN2O2.C4H6N2/c21-17-8-2-1-7-16(17)14-5-3-6-15(11-14)23-12-18(22-13-23)20(24)19-9-4-10-25-19;1-6-3-2-5-4-6/h1-13H;2-4H,1H3.
What are the key properties of [1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole?
[1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole has a molecular weight of 430.90 g/mol, XLogP of 5.44, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-(2-chlorophenyl)phenyl]imidazol-4-yl]-(furan-2-yl)methanone;1-methylimidazole is sourced from PubChem (CID 67430070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).