About [1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan
[1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan (PubChem CID 159044430) has the molecular formula C24H17FN4O2
and a molecular weight of 412.42 g/mol. Its IUPAC name is [1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan.
Molecular Properties
| Compound Name | [1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan |
| PubChem CID | 159044430 |
| Molecular Formula | C24H17FN4O2 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan |
| SMILES | O=C(c1ccccn1)c1cn(-c2cccc(-c3ccncc3F)c2)cn1.c1ccoc1 |
| InChI | InChI=1S/C20H13FN4O.C4H4O/c21-17-11-22-9-7-16(17)14-4-3-5-15(10-14)25-12-19(24-13-25)20(26)18-6-1-2-8-23-18;1-2-4-5-3-1/h1-13H;1-4H |
| InChIKey | JWLYPIKVDLRNSD-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan?
The IUPAC name of [1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan (CID 159044430) is [1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan.
What is the SMILES notation for [1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan?
The canonical SMILES for [1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan is O=C(c1ccccn1)c1cn(-c2cccc(-c3ccncc3F)c2)cn1.c1ccoc1.
What is the InChIKey of [1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan?
The InChIKey is JWLYPIKVDLRNSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13FN4O.C4H4O/c21-17-11-22-9-7-16(17)14-4-3-5-15(10-14)25-12-19(24-13-25)20(26)18-6-1-2-8-23-18;1-2-4-5-3-1/h1-13H;1-4H.
What are the key properties of [1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan?
[1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan has a molecular weight of 412.42 g/mol, XLogP of 4.98, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3-(3-fluoro-4-pyridinyl)phenyl]imidazol-4-yl]-pyridin-2-ylmethanone;furan is sourced from PubChem (CID 159044430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).