C24H17N3O2 — CID 67430776
2-[3-[4-(3-methoxybenzoyl)imidazol-1-yl]phenyl]benzonitrile (PubChem CID 67430776) has the molecular formula C24H17N3O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-[3-[4-(3-methoxybenzoyl)imidazol-1-yl]phenyl]benzonitrile.
| Compound Name | 2-[3-[4-(3-methoxybenzoyl)imidazol-1-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 67430776 |
| Molecular Formula | C24H17N3O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 2-[3-[4-(3-methoxybenzoyl)imidazol-1-yl]phenyl]benzonitrile |
| SMILES | COc1cccc(C(=O)c2cn(-c3cccc(-c4ccccc4C#N)c3)cn2)c1 |
| InChI | InChI=1S/C24H17N3O2/c1-29-21-10-5-8-18(13-21)24(28)23-15-27(16-26-23)20-9-4-7-17(12-20)22-11-3-2-6-19(22)14-25/h2-13,15-16H,1H3 |
| InChIKey | KZPFIKYSUIHKKT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |