C24H17F3N2O3 — CID 67429654
(2-methoxyphenyl)-[1-[3-[2-(trifluoromethoxy)phenyl]phenyl]imidazol-4-yl]methanone (PubChem CID 67429654) has the molecular formula C24H17F3N2O3 and a molecular weight of 438.41 g/mol. Its IUPAC name is (2-methoxyphenyl)-[1-[3-[2-(trifluoromethoxy)phenyl]phenyl]imidazol-4-yl]methanone.
| Compound Name | (2-methoxyphenyl)-[1-[3-[2-(trifluoromethoxy)phenyl]phenyl]imidazol-4-yl]methanone |
|---|---|
| PubChem CID | 67429654 |
| Molecular Formula | C24H17F3N2O3 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | (2-methoxyphenyl)-[1-[3-[2-(trifluoromethoxy)phenyl]phenyl]imidazol-4-yl]methanone |
| SMILES | COc1ccccc1C(=O)c1cn(-c2cccc(-c3ccccc3OC(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C24H17F3N2O3/c1-31-21-11-4-3-10-19(21)23(30)20-14-29(15-28-20)17-8-6-7-16(13-17)18-9-2-5-12-22(18)32-24(25,26)27/h2-15H,1H3 |
| InChIKey | SIGMNVCIIPOVPO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |