C38H29N5 — CID 166789044
N-[(1Z,3E)-1-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-4-pyridin-3-ylpenta-1,3-dienyl]methanimine (PubChem CID 166789044) has the molecular formula C38H29N5 and a molecular weight of 555.69 g/mol. Its IUPAC name is N-[(1Z,3E)-1-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-4-pyridin-3-ylpenta-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3E)-1-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-4-pyridin-3-ylpenta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 166789044 |
| Molecular Formula | C38H29N5 |
| Molecular Weight | 555.69 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | N-[(1Z,3E)-1-[3-[4-phenyl-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]phenyl]-4-pyridin-3-ylpenta-1,3-dienyl]methanimine |
| SMILES | C=N/C(=C\C=C(/C)c1cccnc1)c1cccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccccc4)cc3)n2)c1 |
| InChI | InChI=1S/C38H29N5/c1-27(34-17-10-24-40-26-34)18-23-35(39-2)32-15-9-16-33(25-32)38-42-36(30-13-7-4-8-14-30)41-37(43-38)31-21-19-29(20-22-31)28-11-5-3-6-12-28/h3-26H,2H2,1H3/b27-18+,35-23- |
| InChIKey | YKJHINUVWSDKPA-CPGRQVSDSA-N |
| XLogP | 9.08 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.69 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|