C22H21ClN4O3S — CID 166789392
[5-[C-[5-chloro-2-(4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridin-3-yl)-2,3-dihydro-1-benzofuran-7-yl]-N-methylcarbonimidoyl]-4-(methylideneamino)thiophen-2-yl]methanol (PubChem CID 166789392) has the molecular formula C22H21ClN4O3S and a molecular weight of 456.96 g/mol. Its IUPAC name is [5-[C-[5-chloro-2-(4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridin-3-yl)-2,3-dihydro-1-benzofuran-7-yl]-N-methylcarbonimidoyl]-4-(methylideneamino)thiophen-2-yl]methanol.
| Compound Name | [5-[C-[5-chloro-2-(4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridin-3-yl)-2,3-dihydro-1-benzofuran-7-yl]-N-methylcarbonimidoyl]-4-(methylideneamino)thiophen-2-yl]methanol |
|---|---|
| PubChem CID | 166789392 |
| Molecular Formula | C22H21ClN4O3S |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | [5-[C-[5-chloro-2-(4,5,6,7-tetrahydro-[1,2]oxazolo[4,3-c]pyridin-3-yl)-2,3-dihydro-1-benzofuran-7-yl]-N-methylcarbonimidoyl]-4-(methylideneamino)thiophen-2-yl]methanol |
| SMILES | C=Nc1cc(CO)sc1/C(=N\C)c1cc(Cl)cc2c1OC(c1onc3c1CNCC3)C2 |
| InChI | InChI=1S/C22H21ClN4O3S/c1-24-17-8-13(10-28)31-22(17)19(25-2)14-7-12(23)5-11-6-18(29-20(11)14)21-15-9-26-4-3-16(15)27-30-21/h5,7-8,18,26,28H,1,3-4,6,9-10H2,2H3/b25-19- |
| InChIKey | VPCSIMPUSUEDBF-PLRJNAJWSA-N |
| XLogP | 4.00 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|