C28H30N6O3 — CID 166790852
2-[2-amino-4-methoxy-5-[[4-(7-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)pyrimidin-2-yl]amino]-3-methylphenyl]prop-2-enamide (PubChem CID 166790852) has the molecular formula C28H30N6O3 and a molecular weight of 498.59 g/mol. Its IUPAC name is 2-[2-amino-4-methoxy-5-[[4-(7-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)pyrimidin-2-yl]amino]-3-methylphenyl]prop-2-enamide.
| Compound Name | 2-[2-amino-4-methoxy-5-[[4-(7-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)pyrimidin-2-yl]amino]-3-methylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166790852 |
| Molecular Formula | C28H30N6O3 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 2-[2-amino-4-methoxy-5-[[4-(7-methoxy-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl)pyrimidin-2-yl]amino]-3-methylphenyl]prop-2-enamide |
| SMILES | C=C(C(N)=O)c1cc(Nc2nccc(-c3c4n(c5ccccc35)CC(OC)CC4)n2)c(OC)c(C)c1N |
| InChI | InChI=1S/C28H30N6O3/c1-15(27(30)35)19-13-21(26(37-4)16(2)25(19)29)33-28-31-12-11-20(32-28)24-18-7-5-6-8-22(18)34-14-17(36-3)9-10-23(24)34/h5-8,11-13,17H,1,9-10,14,29H2,2-4H3,(H2,30,35)(H,31,32,33) |
| InChIKey | QJPJDLYPCULMGF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|